C19H31N3O2 — CID 91911504
1'-(2-cyclohexylacetyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one (PubChem CID 91911504) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 1'-(2-cyclohexylacetyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one.
| Compound Name | 1'-(2-cyclohexylacetyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 91911504 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 1'-(2-cyclohexylacetyl)spiro[2,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7,4'-piperidine]-1-one |
| SMILES | O=C1NCCN2CC3(CCN(C(=O)CC4CCCCC4)CC3)CC12 |
| InChI | InChI=1S/C19H31N3O2/c23-17(12-15-4-2-1-3-5-15)21-9-6-19(7-10-21)13-16-18(24)20-8-11-22(16)14-19/h15-16H,1-14H2,(H,20,24) |
| InChIKey | GEEAKVNTKOAQQA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |