C15H20FN3O3S — CID 91913082
3-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-1-methylpyrrolidin-2-one (PubChem CID 91913082) has the molecular formula C15H20FN3O3S and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-1-methylpyrrolidin-2-one.
| Compound Name | 3-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 91913082 |
| Molecular Formula | C15H20FN3O3S |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-1-methylpyrrolidin-2-one |
| SMILES | CN1CCC(N2CCN(S(=O)(=O)c3cccc(F)c3)CC2)C1=O |
| InChI | InChI=1S/C15H20FN3O3S/c1-17-6-5-14(15(17)20)18-7-9-19(10-8-18)23(21,22)13-4-2-3-12(16)11-13/h2-4,11,14H,5-10H2,1H3 |
| InChIKey | MKWANSVKRIWHHC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |