C18H24F3N3O — CID 91921382
N-methyl-4-[1-[(2,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]piperidine-1-carboxamide (PubChem CID 91921382) has the molecular formula C18H24F3N3O and a molecular weight of 355.40 g/mol. Its IUPAC name is N-methyl-4-[1-[(2,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]piperidine-1-carboxamide.
| Compound Name | N-methyl-4-[1-[(2,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91921382 |
| Molecular Formula | C18H24F3N3O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-methyl-4-[1-[(2,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]piperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCC(C2CCN(Cc3cc(F)c(F)cc3F)C2)CC1 |
| InChI | InChI=1S/C18H24F3N3O/c1-22-18(25)24-6-3-12(4-7-24)13-2-5-23(10-13)11-14-8-16(20)17(21)9-15(14)19/h8-9,12-13H,2-7,10-11H2,1H3,(H,22,25) |
| InChIKey | QGUJEZCCWPNGSL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|