C15H18F3NO — CID 97159790
(4aR,8aR)-6-[(2,4,5-trifluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine (PubChem CID 97159790) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is (4aR,8aR)-6-[(2,4,5-trifluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine.
| Compound Name | (4aR,8aR)-6-[(2,4,5-trifluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 97159790 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (4aR,8aR)-6-[(2,4,5-trifluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
| SMILES | Fc1cc(F)c(CN2CC[C@H]3OCCC[C@@H]3C2)cc1F |
| InChI | InChI=1S/C15H18F3NO/c16-12-7-14(18)13(17)6-11(12)9-19-4-3-15-10(8-19)2-1-5-20-15/h6-7,10,15H,1-5,8-9H2/t10-,15-/m1/s1 |
| InChIKey | XEZSXGNRIIRRID-MEBBXXQBSA-N |
| XLogP | 3.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|