C17H25N3O4 — CID 91925645
6-methoxy-N-[(1R,2S)-2-(3-methoxypropylcarbamoyl)cyclopentyl]pyridine-3-carboxamide (PubChem CID 91925645) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 6-methoxy-N-[(1R,2S)-2-(3-methoxypropylcarbamoyl)cyclopentyl]pyridine-3-carboxamide.
| Compound Name | 6-methoxy-N-[(1R,2S)-2-(3-methoxypropylcarbamoyl)cyclopentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91925645 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 6-methoxy-N-[(1R,2S)-2-(3-methoxypropylcarbamoyl)cyclopentyl]pyridine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@H]1CCC[C@H]1NC(=O)c1ccc(OC)nc1 |
| InChI | InChI=1S/C17H25N3O4/c1-23-10-4-9-18-17(22)13-5-3-6-14(13)20-16(21)12-7-8-15(24-2)19-11-12/h7-8,11,13-14H,3-6,9-10H2,1-2H3,(H,18,22)(H,20,21)/t13-,14+/m0/s1 |
| InChIKey | ZOLILWGBSVKTKQ-UONOGXRCSA-N |
| XLogP | 1.14 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|