C19H29N3O4 — CID 91913037
6-methoxy-N-[(1R,2S)-2-(3-propan-2-yloxypropylcarbamoyl)cyclopentyl]pyridine-3-carboxamide (PubChem CID 91913037) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 6-methoxy-N-[(1R,2S)-2-(3-propan-2-yloxypropylcarbamoyl)cyclopentyl]pyridine-3-carboxamide.
| Compound Name | 6-methoxy-N-[(1R,2S)-2-(3-propan-2-yloxypropylcarbamoyl)cyclopentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91913037 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 6-methoxy-N-[(1R,2S)-2-(3-propan-2-yloxypropylcarbamoyl)cyclopentyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CCC[C@@H]2C(=O)NCCCOC(C)C)cn1 |
| InChI | InChI=1S/C19H29N3O4/c1-13(2)26-11-5-10-20-19(24)15-6-4-7-16(15)22-18(23)14-8-9-17(25-3)21-12-14/h8-9,12-13,15-16H,4-7,10-11H2,1-3H3,(H,20,24)(H,22,23)/t15-,16+/m0/s1 |
| InChIKey | MCYCRGYVXGWBAU-JKSUJKDBSA-N |
| XLogP | 1.92 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|