C15H11F3N4 — CID 91926262
[4-naphthalen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine (PubChem CID 91926262) has the molecular formula C15H11F3N4 and a molecular weight of 304.28 g/mol. Its IUPAC name is [4-naphthalen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-naphthalen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 91926262 |
| Molecular Formula | C15H11F3N4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [4-naphthalen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc3ccccc3c2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H11F3N4/c16-15(17,18)13-8-12(20-14(21-13)22-19)11-6-5-9-3-1-2-4-10(9)7-11/h1-8H,19H2,(H,20,21,22) |
| InChIKey | DKGCHLRRCHOXGP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|