C10H4F5NO2S — CID 91926665
furan-2-yl-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 91926665) has the molecular formula C10H4F5NO2S and a molecular weight of 297.20 g/mol. Its IUPAC name is furan-2-yl-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | furan-2-yl-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 91926665 |
| Molecular Formula | C10H4F5NO2S |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | furan-2-yl-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1ccco1)c1scnc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H4F5NO2S/c11-9(12,10(13,14)15)8-7(19-4-16-8)6(17)5-2-1-3-18-5/h1-4H |
| InChIKey | CABBOWQLOXUDPA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|