C9H6F3N3O6S — CID 91927826
methyl N-[2,6-dinitro-4-(trifluoromethylsulfanyl)phenyl]carbamate (PubChem CID 91927826) has the molecular formula C9H6F3N3O6S and a molecular weight of 341.22 g/mol. Its IUPAC name is methyl N-[2,6-dinitro-4-(trifluoromethylsulfanyl)phenyl]carbamate.
| Compound Name | methyl N-[2,6-dinitro-4-(trifluoromethylsulfanyl)phenyl]carbamate |
|---|---|
| PubChem CID | 91927826 |
| Molecular Formula | C9H6F3N3O6S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | methyl N-[2,6-dinitro-4-(trifluoromethylsulfanyl)phenyl]carbamate |
| SMILES | COC(=O)Nc1c([N+](=O)[O-])cc(SC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6F3N3O6S/c1-21-8(16)13-7-5(14(17)18)2-4(22-9(10,11)12)3-6(7)15(19)20/h2-3H,1H3,(H,13,16) |
| InChIKey | AZBBWLHGHWYXBO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|