C16H14NOS- — CID 91928068
cyclopenta-1,4-dien-1-yl-[2-(2-methylphenyl)-1,3-thiazol-5-yl]methanol (PubChem CID 91928068) has the molecular formula C16H14NOS- and a molecular weight of 268.36 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-yl-[2-(2-methylphenyl)-1,3-thiazol-5-yl]methanol.
| Compound Name | cyclopenta-1,4-dien-1-yl-[2-(2-methylphenyl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 91928068 |
| Molecular Formula | C16H14NOS- |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | cyclopenta-1,4-dien-1-yl-[2-(2-methylphenyl)-1,3-thiazol-5-yl]methanol |
| SMILES | Cc1ccccc1-c1ncc(C(O)c2cc[cH-]c2)s1 |
| InChI | InChI=1S/C16H14NOS/c1-11-6-2-5-9-13(11)16-17-10-14(19-16)15(18)12-7-3-4-8-12/h2-10,15,18H,1H3/q-1 |
| InChIKey | LOJNPJRUSYKTSR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|