C27H32NO3- — CID 91929216
3-[2-[7-(1-hydroxynonyl)quinolin-2-yl]ethyl]benzoate (PubChem CID 91929216) has the molecular formula C27H32NO3- and a molecular weight of 418.56 g/mol. Its IUPAC name is 3-[2-[7-(1-hydroxynonyl)quinolin-2-yl]ethyl]benzoate.
| Compound Name | 3-[2-[7-(1-hydroxynonyl)quinolin-2-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 91929216 |
| Molecular Formula | C27H32NO3- |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 3-[2-[7-(1-hydroxynonyl)quinolin-2-yl]ethyl]benzoate |
| SMILES | CCCCCCCCC(O)c1ccc2ccc(CCc3cccc(C(=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C27H33NO3/c1-2-3-4-5-6-7-11-26(29)22-14-13-21-15-17-24(28-25(21)19-22)16-12-20-9-8-10-23(18-20)27(30)31/h8-10,13-15,17-19,26,29H,2-7,11-12,16H2,1H3,(H,30,31)/p-1 |
| InChIKey | RCRMFVPQIWPMAL-UHFFFAOYSA-M |
| XLogP | 5.17 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|