C17H23N3OS — CID 91933282
heptan-2-yl-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]diazene (PubChem CID 91933282) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is heptan-2-yl-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]diazene.
| Compound Name | heptan-2-yl-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]diazene |
|---|---|
| PubChem CID | 91933282 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | heptan-2-yl-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]diazene |
| SMILES | CCCCCC(C)/N=N/c1nc(-c2cccc(OC)c2)cs1 |
| InChI | InChI=1S/C17H23N3OS/c1-4-5-6-8-13(2)19-20-17-18-16(12-22-17)14-9-7-10-15(11-14)21-3/h7,9-13H,4-6,8H2,1-3H3/b20-19+ |
| InChIKey | HYVNXUPTGRWKOB-FMQUCBEESA-N |
| XLogP | 5.87 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|