C20H19F6NO4S — CID 91933909
2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]acetamide (PubChem CID 91933909) has the molecular formula C20H19F6NO4S and a molecular weight of 483.43 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 91933909 |
| Molecular Formula | C20H19F6NO4S |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(OC)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H19F6NO4S/c1-3-32(29,30)16-10-4-13(5-11-16)12-17(28)27-15-8-6-14(7-9-15)18(31-2,19(21,22)23)20(24,25)26/h4-11H,3,12H2,1-2H3,(H,27,28) |
| InChIKey | XCYAYGZSVGESNE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |