C25H26N4O5 — CID 91936420
5-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]imino-2-prop-2-ynoxycyclohex-2-ene-1,4-dione (PubChem CID 91936420) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is 5-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]imino-2-prop-2-ynoxycyclohex-2-ene-1,4-dione.
| Compound Name | 5-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]imino-2-prop-2-ynoxycyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 91936420 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 5-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]imino-2-prop-2-ynoxycyclohex-2-ene-1,4-dione |
| SMILES | C#CCOC1=CC(=O)/C(=N/c2ncnc3cc(OCCCN4CCCC4)c(OC)cc23)CC1=O |
| InChI | InChI=1S/C25H26N4O5/c1-3-10-33-22-15-20(30)19(13-21(22)31)28-25-17-12-23(32-2)24(14-18(17)26-16-27-25)34-11-6-9-29-7-4-5-8-29/h1,12,14-16H,4-11,13H2,2H3/b28-19+ |
| InChIKey | UPQQZTMIRXWKNI-TURZUDJPSA-N |
| XLogP | 2.65 |
| TPSA | 103.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|