C24H26N4O7 — CID 90717190
1-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]imino-3,6-dioxocyclohexen-1-yl]piperidine-4-carboxylic acid (PubChem CID 90717190) has the molecular formula C24H26N4O7 and a molecular weight of 482.49 g/mol. Its IUPAC name is 1-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]imino-3,6-dioxocyclohexen-1-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]imino-3,6-dioxocyclohexen-1-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 90717190 |
| Molecular Formula | C24H26N4O7 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 1-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]imino-3,6-dioxocyclohexen-1-yl]piperidine-4-carboxylic acid |
| SMILES | COCCOc1cc2ncnc(/N=C3\CC(=O)C(N4CCC(C(=O)O)CC4)=CC3=O)c2cc1OC |
| InChI | InChI=1S/C24H26N4O7/c1-33-7-8-35-22-11-16-15(9-21(22)34-2)23(26-13-25-16)27-17-10-20(30)18(12-19(17)29)28-5-3-14(4-6-28)24(31)32/h9,11-14H,3-8,10H2,1-2H3,(H,31,32)/b27-17+ |
| InChIKey | QRMSLCYCVDMDOP-WPWMEQJKSA-N |
| XLogP | 1.96 |
| TPSA | 140.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|