C22H20N4O6S2 — CID 90746518
3-methoxy-5-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]imino-2-(1,3-thiazol-5-ylsulfanyl)cyclohex-2-ene-1,4-dione (PubChem CID 90746518) has the molecular formula C22H20N4O6S2 and a molecular weight of 500.56 g/mol. Its IUPAC name is 3-methoxy-5-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]imino-2-(1,3-thiazol-5-ylsulfanyl)cyclohex-2-ene-1,4-dione.
| Compound Name | 3-methoxy-5-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]imino-2-(1,3-thiazol-5-ylsulfanyl)cyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 90746518 |
| Molecular Formula | C22H20N4O6S2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 3-methoxy-5-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]imino-2-(1,3-thiazol-5-ylsulfanyl)cyclohex-2-ene-1,4-dione |
| SMILES | COCCOc1cc2ncnc(/N=C3/CC(=O)C(Sc4cncs4)=C(OC)C3=O)c2cc1OC |
| InChI | InChI=1S/C22H20N4O6S2/c1-29-4-5-32-17-8-13-12(6-16(17)30-2)22(25-10-24-13)26-14-7-15(27)21(20(31-3)19(14)28)34-18-9-23-11-33-18/h6,8-11H,4-5,7H2,1-3H3/b26-14- |
| InChIKey | VPXAWMWTPBNQOB-WGARJPEWSA-N |
| XLogP | 3.38 |
| TPSA | 122.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|