C18H18N6O5 — CID 91937039
4-(2,4-dihydroxyphenyl)-2-hydrazinyl-6-methyl-N-(3-nitrophenyl)-4,5-dihydropyrimidine-5-carboxamide (PubChem CID 91937039) has the molecular formula C18H18N6O5 and a molecular weight of 398.38 g/mol. Its IUPAC name is 4-(2,4-dihydroxyphenyl)-2-hydrazinyl-6-methyl-N-(3-nitrophenyl)-4,5-dihydropyrimidine-5-carboxamide.
| Compound Name | 4-(2,4-dihydroxyphenyl)-2-hydrazinyl-6-methyl-N-(3-nitrophenyl)-4,5-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91937039 |
| Molecular Formula | C18H18N6O5 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-(2,4-dihydroxyphenyl)-2-hydrazinyl-6-methyl-N-(3-nitrophenyl)-4,5-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=NC(NN)=NC(c2ccc(O)cc2O)C1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N6O5/c1-9-15(17(27)21-10-3-2-4-11(7-10)24(28)29)16(22-18(20-9)23-19)13-6-5-12(25)8-14(13)26/h2-8,15-16,25-26H,19H2,1H3,(H,21,27)(H,22,23) |
| InChIKey | ANGLIRBRVUCNTD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 175.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|