C25H22N4O5S — CID 45276111
2-benzylsulfanyl-4-(2,4-dihydroxyphenyl)-6-methyl-N-(3-nitrophenyl)-1,4-dihydropyrimidine-5-carboxamide (PubChem CID 45276111) has the molecular formula C25H22N4O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-(2,4-dihydroxyphenyl)-6-methyl-N-(3-nitrophenyl)-1,4-dihydropyrimidine-5-carboxamide.
| Compound Name | 2-benzylsulfanyl-4-(2,4-dihydroxyphenyl)-6-methyl-N-(3-nitrophenyl)-1,4-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 45276111 |
| Molecular Formula | C25H22N4O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-benzylsulfanyl-4-(2,4-dihydroxyphenyl)-6-methyl-N-(3-nitrophenyl)-1,4-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc([N+](=O)[O-])c2)C(c2ccc(O)cc2O)N=C(SCc2ccccc2)N1 |
| InChI | InChI=1S/C25H22N4O5S/c1-15-22(24(32)27-17-8-5-9-18(12-17)29(33)34)23(20-11-10-19(30)13-21(20)31)28-25(26-15)35-14-16-6-3-2-4-7-16/h2-13,23,30-31H,14H2,1H3,(H,26,28)(H,27,32) |
| InChIKey | QZKXCRWQSNLJQJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|