C23H20N6O6 — CID 91937040
4-(2,4-dihydroxyphenyl)-2-[(2E)-2-(furan-2-ylmethylidene)hydrazinyl]-6-methyl-N-(3-nitrophenyl)-4,5-dihydropyrimidine-5-carboxamide (PubChem CID 91937040) has the molecular formula C23H20N6O6 and a molecular weight of 476.45 g/mol. Its IUPAC name is 4-(2,4-dihydroxyphenyl)-2-[(2E)-2-(furan-2-ylmethylidene)hydrazinyl]-6-methyl-N-(3-nitrophenyl)-4,5-dihydropyrimidine-5-carboxamide.
| Compound Name | 4-(2,4-dihydroxyphenyl)-2-[(2E)-2-(furan-2-ylmethylidene)hydrazinyl]-6-methyl-N-(3-nitrophenyl)-4,5-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91937040 |
| Molecular Formula | C23H20N6O6 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 4-(2,4-dihydroxyphenyl)-2-[(2E)-2-(furan-2-ylmethylidene)hydrazinyl]-6-methyl-N-(3-nitrophenyl)-4,5-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=NC(N/N=C/c2ccco2)=NC(c2ccc(O)cc2O)C1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N6O6/c1-13-20(22(32)26-14-4-2-5-15(10-14)29(33)34)21(18-8-7-16(30)11-19(18)31)27-23(25-13)28-24-12-17-6-3-9-35-17/h2-12,20-21,30-31H,1H3,(H,26,32)(H,27,28)/b24-12+ |
| InChIKey | OCUSCYXPLCLQCK-WYMPLXKRSA-N |
| XLogP | 3.35 |
| TPSA | 174.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|