About N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine
N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 91938185) has the molecular formula C17H23ClN4O
and a molecular weight of 334.85 g/mol. Its IUPAC name is N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 91938185 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1cc(N2CCOCC2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H23ClN4O/c1-21(2)6-5-19-16-12-17(22-7-9-23-10-8-22)20-15-4-3-13(18)11-14(15)16/h3-4,11-12H,5-10H2,1-2H3,(H,19,20) |
| InChIKey | TYBQXBZQAWOBII-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine (CID 91938185) is N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine is CN(C)CCNc1cc(N2CCOCC2)nc2ccc(Cl)cc12.
What is the InChIKey of N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine?
The InChIKey is TYBQXBZQAWOBII-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN4O/c1-21(2)6-5-19-16-12-17(22-7-9-23-10-8-22)20-15-4-3-13(18)11-14(15)16/h3-4,11-12H,5-10H2,1-2H3,(H,19,20).
What are the key properties of N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine?
N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine has a molecular weight of 334.85 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-2-morpholin-4-ylquinolin-4-yl)-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 91938185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).