C17H29N5O — CID 91940250
1-[4-[5-[(dimethylamino)methyl]-4-ethyl-1,2,4-triazol-3-yl]piperidin-1-yl]pent-3-en-1-one (PubChem CID 91940250) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-[4-[5-[(dimethylamino)methyl]-4-ethyl-1,2,4-triazol-3-yl]piperidin-1-yl]pent-3-en-1-one.
| Compound Name | 1-[4-[5-[(dimethylamino)methyl]-4-ethyl-1,2,4-triazol-3-yl]piperidin-1-yl]pent-3-en-1-one |
|---|---|
| PubChem CID | 91940250 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 1-[4-[5-[(dimethylamino)methyl]-4-ethyl-1,2,4-triazol-3-yl]piperidin-1-yl]pent-3-en-1-one |
| SMILES | CC=CCC(=O)N1CCC(c2nnc(CN(C)C)n2CC)CC1 |
| InChI | InChI=1S/C17H29N5O/c1-5-7-8-16(23)21-11-9-14(10-12-21)17-19-18-15(13-20(3)4)22(17)6-2/h5,7,14H,6,8-13H2,1-4H3 |
| InChIKey | CVHLJELVGBHSPC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|