C21H26N2O2 — CID 91940475
1-[(1S,5R)-3-(cyclobutanecarbonyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-3-phenylprop-2-en-1-one (PubChem CID 91940475) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[(1S,5R)-3-(cyclobutanecarbonyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[(1S,5R)-3-(cyclobutanecarbonyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 91940475 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[(1S,5R)-3-(cyclobutanecarbonyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C1CCC1)N1C[C@@H]2CC[C@H](C1)N(C(=O)C=Cc1ccccc1)C2 |
| InChI | InChI=1S/C21H26N2O2/c24-20(12-10-16-5-2-1-3-6-16)23-14-17-9-11-19(23)15-22(13-17)21(25)18-7-4-8-18/h1-3,5-6,10,12,17-19H,4,7-9,11,13-15H2/t17-,19+/m0/s1 |
| InChIKey | MCEKLLZMDGOLCS-PKOBYXMFSA-N |
| XLogP | 2.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|