C16H16N2O4 — CID 91941415
4-[3-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 91941415) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4-[3-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[3-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 91941415 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-[3-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | Cc1nc(CNC(=O)C=Cc2ccc(C(=O)O)cc2)oc1C |
| InChI | InChI=1S/C16H16N2O4/c1-10-11(2)22-15(18-10)9-17-14(19)8-5-12-3-6-13(7-4-12)16(20)21/h3-8H,9H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | HTPIJWZVCRWEHR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|