C17H18F2N2O4 — CID 103598301
3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]prop-2-enamide (PubChem CID 103598301) has the molecular formula C17H18F2N2O4 and a molecular weight of 352.34 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]prop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 103598301 |
| Molecular Formula | C17H18F2N2O4 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NCc2nc(C)c(C)o2)ccc1OC(F)F |
| InChI | InChI=1S/C17H18F2N2O4/c1-10-11(2)24-16(21-10)9-20-15(22)7-5-12-4-6-13(25-17(18)19)14(8-12)23-3/h4-8,17H,9H2,1-3H3,(H,20,22) |
| InChIKey | AHWROUWPMDQIAU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|