C20H22N2O2 — CID 91944269
2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 3-(6-methyl-3-pyridinyl)prop-2-enoate (PubChem CID 91944269) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 3-(6-methyl-3-pyridinyl)prop-2-enoate.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 3-(6-methyl-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 91944269 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 3-(6-methyl-3-pyridinyl)prop-2-enoate |
| SMILES | Cc1ccc(C=CC(=O)OCCN2CCCc3ccccc32)cn1 |
| InChI | InChI=1S/C20H22N2O2/c1-16-8-9-17(15-21-16)10-11-20(23)24-14-13-22-12-4-6-18-5-2-3-7-19(18)22/h2-3,5,7-11,15H,4,6,12-14H2,1H3 |
| InChIKey | LZVIGOCQFXKBSN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|