C19H26ClN4O+ — CID 9194978
[1-[[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]methyl]cyclohexyl]-dimethylazanium (PubChem CID 9194978) has the molecular formula C19H26ClN4O+ and a molecular weight of 361.90 g/mol. Its IUPAC name is [1-[[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]methyl]cyclohexyl]-dimethylazanium.
| Compound Name | [1-[[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]methyl]cyclohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 9194978 |
| Molecular Formula | C19H26ClN4O+ |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | [1-[[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]methyl]cyclohexyl]-dimethylazanium |
| SMILES | C[NH+](C)C1(CNc2cnn(-c3ccccc3)c(=O)c2Cl)CCCCC1 |
| InChI | InChI=1S/C19H25ClN4O/c1-23(2)19(11-7-4-8-12-19)14-21-16-13-22-24(18(25)17(16)20)15-9-5-3-6-10-15/h3,5-6,9-10,13,21H,4,7-8,11-12,14H2,1-2H3/p+1 |
| InChIKey | SKJOUPYPVPBKJM-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |