C17H23N3O4 — CID 91950324
3-(3-methoxypropyl)-6-methyl-5-(piperidine-1-carbonyl)furo[2,3-d]pyrimidin-4-one (PubChem CID 91950324) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-6-methyl-5-(piperidine-1-carbonyl)furo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(3-methoxypropyl)-6-methyl-5-(piperidine-1-carbonyl)furo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 91950324 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-(3-methoxypropyl)-6-methyl-5-(piperidine-1-carbonyl)furo[2,3-d]pyrimidin-4-one |
| SMILES | COCCCn1cnc2oc(C)c(C(=O)N3CCCCC3)c2c1=O |
| InChI | InChI=1S/C17H23N3O4/c1-12-13(16(21)19-7-4-3-5-8-19)14-15(24-12)18-11-20(17(14)22)9-6-10-23-2/h11H,3-10H2,1-2H3 |
| InChIKey | GQOIPNFGICYZNJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|