C23H27FN4O4 — CID 91950213
5-[4-[(4-fluorophenyl)methyl]piperazine-1-carbonyl]-3-(3-methoxypropyl)-6-methylfuro[2,3-d]pyrimidin-4-one (PubChem CID 91950213) has the molecular formula C23H27FN4O4 and a molecular weight of 442.49 g/mol. Its IUPAC name is 5-[4-[(4-fluorophenyl)methyl]piperazine-1-carbonyl]-3-(3-methoxypropyl)-6-methylfuro[2,3-d]pyrimidin-4-one.
| Compound Name | 5-[4-[(4-fluorophenyl)methyl]piperazine-1-carbonyl]-3-(3-methoxypropyl)-6-methylfuro[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 91950213 |
| Molecular Formula | C23H27FN4O4 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 5-[4-[(4-fluorophenyl)methyl]piperazine-1-carbonyl]-3-(3-methoxypropyl)-6-methylfuro[2,3-d]pyrimidin-4-one |
| SMILES | COCCCn1cnc2oc(C)c(C(=O)N3CCN(Cc4ccc(F)cc4)CC3)c2c1=O |
| InChI | InChI=1S/C23H27FN4O4/c1-16-19(20-21(32-16)25-15-28(23(20)30)8-3-13-31-2)22(29)27-11-9-26(10-12-27)14-17-4-6-18(24)7-5-17/h4-7,15H,3,8-14H2,1-2H3 |
| InChIKey | LISOWLRKJCVVJF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|