C18H24N4O3 — CID 91950187
6-methyl-3-prop-2-enyl-5-(4-propylpiperazine-1-carbonyl)furo[2,3-d]pyrimidin-4-one (PubChem CID 91950187) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 6-methyl-3-prop-2-enyl-5-(4-propylpiperazine-1-carbonyl)furo[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-3-prop-2-enyl-5-(4-propylpiperazine-1-carbonyl)furo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 91950187 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 6-methyl-3-prop-2-enyl-5-(4-propylpiperazine-1-carbonyl)furo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1cnc2oc(C)c(C(=O)N3CCN(CCC)CC3)c2c1=O |
| InChI | InChI=1S/C18H24N4O3/c1-4-6-20-8-10-21(11-9-20)17(23)14-13(3)25-16-15(14)18(24)22(7-5-2)12-19-16/h5,12H,2,4,6-11H2,1,3H3 |
| InChIKey | UDZQONQQHNMZTF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|