C17H22N4O3 — CID 91950167
5-(4-ethylpiperazine-1-carbonyl)-6-methyl-3-prop-2-enylfuro[2,3-d]pyrimidin-4-one (PubChem CID 91950167) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 5-(4-ethylpiperazine-1-carbonyl)-6-methyl-3-prop-2-enylfuro[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-ethylpiperazine-1-carbonyl)-6-methyl-3-prop-2-enylfuro[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 91950167 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 5-(4-ethylpiperazine-1-carbonyl)-6-methyl-3-prop-2-enylfuro[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1cnc2oc(C)c(C(=O)N3CCN(CC)CC3)c2c1=O |
| InChI | InChI=1S/C17H22N4O3/c1-4-6-21-11-18-15-14(17(21)23)13(12(3)24-15)16(22)20-9-7-19(5-2)8-10-20/h4,11H,1,5-10H2,2-3H3 |
| InChIKey | AEAJYEUMZKTNHO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|