C17H22N2O4S — CID 91950528
N-(cyclopropylmethyl)-5-(dimethylsulfamoyl)-N-ethyl-1-benzofuran-2-carboxamide (PubChem CID 91950528) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-5-(dimethylsulfamoyl)-N-ethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-5-(dimethylsulfamoyl)-N-ethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 91950528 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-(cyclopropylmethyl)-5-(dimethylsulfamoyl)-N-ethyl-1-benzofuran-2-carboxamide |
| SMILES | CCN(CC1CC1)C(=O)c1cc2cc(S(=O)(=O)N(C)C)ccc2o1 |
| InChI | InChI=1S/C17H22N2O4S/c1-4-19(11-12-5-6-12)17(20)16-10-13-9-14(7-8-15(13)23-16)24(21,22)18(2)3/h7-10,12H,4-6,11H2,1-3H3 |
| InChIKey | FUKRICTXJMNJAY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |