C17H20N4O4S — CID 91950519
5-(dimethylsulfamoyl)-N-(3-imidazol-1-ylpropyl)-1-benzofuran-2-carboxamide (PubChem CID 91950519) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-(3-imidazol-1-ylpropyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-(3-imidazol-1-ylpropyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 91950519 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-(3-imidazol-1-ylpropyl)-1-benzofuran-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2oc(C(=O)NCCCn3ccnc3)cc2c1 |
| InChI | InChI=1S/C17H20N4O4S/c1-20(2)26(23,24)14-4-5-15-13(10-14)11-16(25-15)17(22)19-6-3-8-21-9-7-18-12-21/h4-5,7,9-12H,3,6,8H2,1-2H3,(H,19,22) |
| InChIKey | KVKXLWTYIKRBKF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|