C24H31N5O4S — CID 26144970
3-(dimethylsulfamoyl)-5-[(4-ethoxyphenyl)methylamino]-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 26144970) has the molecular formula C24H31N5O4S and a molecular weight of 485.61 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-5-[(4-ethoxyphenyl)methylamino]-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-5-[(4-ethoxyphenyl)methylamino]-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 26144970 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 3-(dimethylsulfamoyl)-5-[(4-ethoxyphenyl)methylamino]-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | CCOc1ccc(CNc2cc(C(=O)NCCCn3ccnc3)cc(S(=O)(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C24H31N5O4S/c1-4-33-22-8-6-19(7-9-22)17-27-21-14-20(15-23(16-21)34(31,32)28(2)3)24(30)26-10-5-12-29-13-11-25-18-29/h6-9,11,13-16,18,27H,4-5,10,12,17H2,1-3H3,(H,26,30) |
| InChIKey | UHJLDVFRBXRBPE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|