C22H29N5O4S — CID 26143583
3-(dimethylsulfamoyl)-5-[(5-ethylfuran-2-yl)methylamino]-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 26143583) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-5-[(5-ethylfuran-2-yl)methylamino]-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-5-[(5-ethylfuran-2-yl)methylamino]-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 26143583 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 3-(dimethylsulfamoyl)-5-[(5-ethylfuran-2-yl)methylamino]-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | CCc1ccc(CNc2cc(C(=O)NCCCn3ccnc3)cc(S(=O)(=O)N(C)C)c2)o1 |
| InChI | InChI=1S/C22H29N5O4S/c1-4-19-6-7-20(31-19)15-25-18-12-17(13-21(14-18)32(29,30)26(2)3)22(28)24-8-5-10-27-11-9-23-16-27/h6-7,9,11-14,16,25H,4-5,8,10,15H2,1-3H3,(H,24,28) |
| InChIKey | AGDKJEJNRFWLOH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|