C20H22N2O5S — CID 91950507
5-(dimethylsulfamoyl)-N-(3-hydroxy-3-phenylpropyl)-1-benzofuran-2-carboxamide (PubChem CID 91950507) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-(3-hydroxy-3-phenylpropyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-(3-hydroxy-3-phenylpropyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 91950507 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-(3-hydroxy-3-phenylpropyl)-1-benzofuran-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2oc(C(=O)NCCC(O)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C20H22N2O5S/c1-22(2)28(25,26)16-8-9-18-15(12-16)13-19(27-18)20(24)21-11-10-17(23)14-6-4-3-5-7-14/h3-9,12-13,17,23H,10-11H2,1-2H3,(H,21,24) |
| InChIKey | SXMBKEACZHPESH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |