C21H28N2O6 — CID 91953182
3-(4-methoxyphenyl)-5-oxo-5-[4-(oxolane-2-carbonyl)piperazin-1-yl]pentanoic acid (PubChem CID 91953182) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-oxo-5-[4-(oxolane-2-carbonyl)piperazin-1-yl]pentanoic acid.
| Compound Name | 3-(4-methoxyphenyl)-5-oxo-5-[4-(oxolane-2-carbonyl)piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 91953182 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-oxo-5-[4-(oxolane-2-carbonyl)piperazin-1-yl]pentanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)CC(=O)N2CCN(C(=O)C3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C21H28N2O6/c1-28-17-6-4-15(5-7-17)16(14-20(25)26)13-19(24)22-8-10-23(11-9-22)21(27)18-3-2-12-29-18/h4-7,16,18H,2-3,8-14H2,1H3,(H,25,26) |
| InChIKey | OACKHKVYIORWOU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |