C20H25ClN2O5 — CID 91953222
3-(4-chlorophenyl)-5-oxo-5-[4-(oxolane-2-carbonyl)piperazin-1-yl]pentanoic acid (PubChem CID 91953222) has the molecular formula C20H25ClN2O5 and a molecular weight of 408.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-oxo-5-[4-(oxolane-2-carbonyl)piperazin-1-yl]pentanoic acid.
| Compound Name | 3-(4-chlorophenyl)-5-oxo-5-[4-(oxolane-2-carbonyl)piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 91953222 |
| Molecular Formula | C20H25ClN2O5 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 3-(4-chlorophenyl)-5-oxo-5-[4-(oxolane-2-carbonyl)piperazin-1-yl]pentanoic acid |
| SMILES | O=C(O)CC(CC(=O)N1CCN(C(=O)C2CCCO2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H25ClN2O5/c21-16-5-3-14(4-6-16)15(13-19(25)26)12-18(24)22-7-9-23(10-8-22)20(27)17-2-1-11-28-17/h3-6,15,17H,1-2,7-13H2,(H,25,26) |
| InChIKey | NFZCYKDOOBUULD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |