C15H19N3O — CID 91953494
2-[1-(1,6-naphthyridin-8-yl)piperidin-2-yl]ethanol (PubChem CID 91953494) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-[1-(1,6-naphthyridin-8-yl)piperidin-2-yl]ethanol.
| Compound Name | 2-[1-(1,6-naphthyridin-8-yl)piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 91953494 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-[1-(1,6-naphthyridin-8-yl)piperidin-2-yl]ethanol |
| SMILES | OCCC1CCCCN1c1cncc2cccnc12 |
| InChI | InChI=1S/C15H19N3O/c19-9-6-13-5-1-2-8-18(13)14-11-16-10-12-4-3-7-17-15(12)14/h3-4,7,10-11,13,19H,1-2,5-6,8-9H2 |
| InChIKey | WISDHNKVWGECOG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |