C21H23ClN4O2 — CID 9195368
4-chloro-5-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]-2-phenylpyridazin-3-one (PubChem CID 9195368) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is 4-chloro-5-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 9195368 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-chloro-5-[[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]-2-phenylpyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC[C@@H](c2ccco2)N2CCCCC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C21H23ClN4O2/c22-20-17(14-24-26(21(20)27)16-8-3-1-4-9-16)23-15-18(19-10-7-13-28-19)25-11-5-2-6-12-25/h1,3-4,7-10,13-14,18,23H,2,5-6,11-12,15H2/t18-/m0/s1 |
| InChIKey | AWUHBOPDBUGNHK-SFHVURJKSA-N |
| XLogP | 4.12 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |