C22H32N4O3 — CID 91957844
3-(6-methylindazol-1-yl)-N-[[4-(morpholin-4-ylmethyl)oxan-4-yl]methyl]propanamide (PubChem CID 91957844) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-(6-methylindazol-1-yl)-N-[[4-(morpholin-4-ylmethyl)oxan-4-yl]methyl]propanamide.
| Compound Name | 3-(6-methylindazol-1-yl)-N-[[4-(morpholin-4-ylmethyl)oxan-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 91957844 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 3-(6-methylindazol-1-yl)-N-[[4-(morpholin-4-ylmethyl)oxan-4-yl]methyl]propanamide |
| SMILES | Cc1ccc2cnn(CCC(=O)NCC3(CN4CCOCC4)CCOCC3)c2c1 |
| InChI | InChI=1S/C22H32N4O3/c1-18-2-3-19-15-24-26(20(19)14-18)7-4-21(27)23-16-22(5-10-28-11-6-22)17-25-8-12-29-13-9-25/h2-3,14-15H,4-13,16-17H2,1H3,(H,23,27) |
| InChIKey | QQPMFVVOJAXYJO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |