C23H33N3O4 — CID 91957994
2,6-dimethyl-3-oxo-N-[[4-(piperidin-1-ylmethyl)oxan-4-yl]methyl]-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 91957994) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 2,6-dimethyl-3-oxo-N-[[4-(piperidin-1-ylmethyl)oxan-4-yl]methyl]-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | 2,6-dimethyl-3-oxo-N-[[4-(piperidin-1-ylmethyl)oxan-4-yl]methyl]-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 91957994 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 2,6-dimethyl-3-oxo-N-[[4-(piperidin-1-ylmethyl)oxan-4-yl]methyl]-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)NC(=O)C(C)(C(=O)NCC1(CN3CCCCC3)CCOCC1)O2 |
| InChI | InChI=1S/C23H33N3O4/c1-17-6-7-19-18(14-17)25-21(28)22(2,30-19)20(27)24-15-23(8-12-29-13-9-23)16-26-10-4-3-5-11-26/h6-7,14H,3-5,8-13,15-16H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | JPPPGKBBPATOGA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|