C22H26N4O3S — CID 91958453
4,4-dimethyl-N-[3-(3-methylindazol-2-yl)propyl]-2-oxo-1,3-dihydroquinoline-6-sulfonamide (PubChem CID 91958453) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 4,4-dimethyl-N-[3-(3-methylindazol-2-yl)propyl]-2-oxo-1,3-dihydroquinoline-6-sulfonamide.
| Compound Name | 4,4-dimethyl-N-[3-(3-methylindazol-2-yl)propyl]-2-oxo-1,3-dihydroquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 91958453 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 4,4-dimethyl-N-[3-(3-methylindazol-2-yl)propyl]-2-oxo-1,3-dihydroquinoline-6-sulfonamide |
| SMILES | Cc1c2ccccc2nn1CCCNS(=O)(=O)c1ccc2c(c1)C(C)(C)CC(=O)N2 |
| InChI | InChI=1S/C22H26N4O3S/c1-15-17-7-4-5-8-19(17)25-26(15)12-6-11-23-30(28,29)16-9-10-20-18(13-16)22(2,3)14-21(27)24-20/h4-5,7-10,13,23H,6,11-12,14H2,1-3H3,(H,24,27) |
| InChIKey | ZURCHLYLVOSWFX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|