C18H19N3O4S — CID 91938558
3-[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)sulfonylamino]benzamide (PubChem CID 91938558) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 3-[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)sulfonylamino]benzamide.
| Compound Name | 3-[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 91938558 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 3-[(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)sulfonylamino]benzamide |
| SMILES | CC1(C)CC(=O)Nc2ccc(S(=O)(=O)Nc3cccc(C(N)=O)c3)cc21 |
| InChI | InChI=1S/C18H19N3O4S/c1-18(2)10-16(22)20-15-7-6-13(9-14(15)18)26(24,25)21-12-5-3-4-11(8-12)17(19)23/h3-9,21H,10H2,1-2H3,(H2,19,23)(H,20,22) |
| InChIKey | ZJTMOMKDWMIBPP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |