C18H17BrN4O2 — CID 91958694
2-bromo-N-(3-indazol-2-ylpropyl)-4-methylfuro[3,2-b]pyrrole-5-carboxamide (PubChem CID 91958694) has the molecular formula C18H17BrN4O2 and a molecular weight of 401.26 g/mol. Its IUPAC name is 2-bromo-N-(3-indazol-2-ylpropyl)-4-methylfuro[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-bromo-N-(3-indazol-2-ylpropyl)-4-methylfuro[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 91958694 |
| Molecular Formula | C18H17BrN4O2 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2-bromo-N-(3-indazol-2-ylpropyl)-4-methylfuro[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cn1c(C(=O)NCCCn2cc3ccccc3n2)cc2oc(Br)cc21 |
| InChI | InChI=1S/C18H17BrN4O2/c1-22-14-10-17(19)25-16(14)9-15(22)18(24)20-7-4-8-23-11-12-5-2-3-6-13(12)21-23/h2-3,5-6,9-11H,4,7-8H2,1H3,(H,20,24) |
| InChIKey | XXIFVVSYAWFERL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|