C22H19N3O3S — CID 9196176
12-(3,5-dimethoxyphenoxy)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 9196176) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 12-(3,5-dimethoxyphenoxy)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-(3,5-dimethoxyphenoxy)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 9196176 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 12-(3,5-dimethoxyphenoxy)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | COc1cc(OC)cc(Oc2nc(-c3cccnc3)nc3sc4c(c23)CCC4)c1 |
| InChI | InChI=1S/C22H19N3O3S/c1-26-14-9-15(27-2)11-16(10-14)28-21-19-17-6-3-7-18(17)29-22(19)25-20(24-21)13-5-4-8-23-12-13/h4-5,8-12H,3,6-7H2,1-2H3 |
| InChIKey | MBXKGLFMSFLORT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |