C22H26ClN5O — CID 91964165
2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]quinazolin-4-yl]amino]butan-1-ol (PubChem CID 91964165) has the molecular formula C22H26ClN5O and a molecular weight of 411.94 g/mol. Its IUPAC name is 2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]quinazolin-4-yl]amino]butan-1-ol.
| Compound Name | 2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]quinazolin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 91964165 |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]quinazolin-4-yl]amino]butan-1-ol |
| SMILES | CCC(CO)Nc1nc(N2CCN(c3cccc(Cl)c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C22H26ClN5O/c1-2-17(15-29)24-21-19-8-3-4-9-20(19)25-22(26-21)28-12-10-27(11-13-28)18-7-5-6-16(23)14-18/h3-9,14,17,29H,2,10-13,15H2,1H3,(H,24,25,26) |
| InChIKey | HPVILJXRTZALJA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |