C18H13N3O2 — CID 91964191
3-[[2-(furan-2-yl)quinazolin-4-yl]amino]phenol (PubChem CID 91964191) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-[[2-(furan-2-yl)quinazolin-4-yl]amino]phenol.
| Compound Name | 3-[[2-(furan-2-yl)quinazolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 91964191 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-[[2-(furan-2-yl)quinazolin-4-yl]amino]phenol |
| SMILES | Oc1cccc(Nc2nc(-c3ccco3)nc3ccccc23)c1 |
| InChI | InChI=1S/C18H13N3O2/c22-13-6-3-5-12(11-13)19-17-14-7-1-2-8-15(14)20-18(21-17)16-9-4-10-23-16/h1-11,22H,(H,19,20,21) |
| InChIKey | QQQGDYCWXDQCDF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |