About 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine
4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine (PubChem CID 91973249) has the molecular formula C9H6F3N3
and a molecular weight of 213.16 g/mol. Its IUPAC name is 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine.
Analyze 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine?
The IUPAC name of 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine (CID 91973249) is 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine.
What is the SMILES notation for 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine?
The canonical SMILES for 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine is Cc1ncnc2ccnc(C(F)(F)F)c12.
What is the InChIKey of 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine?
The InChIKey is BCICKVIGGRKXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3N3/c1-5-7-6(15-4-14-5)2-3-13-8(7)9(10,11)12/h2-4H,1H3.
What are the key properties of 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine?
4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine has a molecular weight of 213.16 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-(trifluoromethyl)pyrido[4,3-d]pyrimidine is sourced from PubChem (CID 91973249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).