C8H7N2NaO2 — CID 91980030
sodium 1,4-dimethyl-2,6-dioxo-3H-pyridin-3-ide-5-carbonitrile (PubChem CID 91980030) has the molecular formula C8H7N2NaO2 and a molecular weight of 186.15 g/mol. Its IUPAC name is sodium 1,4-dimethyl-2,6-dioxo-3H-pyridin-3-ide-5-carbonitrile.
| Compound Name | sodium 1,4-dimethyl-2,6-dioxo-3H-pyridin-3-ide-5-carbonitrile |
|---|---|
| PubChem CID | 91980030 |
| Molecular Formula | C8H7N2NaO2 |
| Molecular Weight | 186.15 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | sodium 1,4-dimethyl-2,6-dioxo-3H-pyridin-3-ide-5-carbonitrile |
| SMILES | Cc1[cH-]c(=O)n(C)c(=O)c1C#N.[Na+] |
| InChI | InChI=1S/C8H7N2O2.Na/c1-5-3-7(11)10(2)8(12)6(5)4-9;/h3H,1-2H3;/q-1;+1 |
| InChIKey | DHMFGKUPOXTHPS-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 62.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.15 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|