C10H10N2O2 — CID 171037472
5-ethylidene-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 171037472) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-ethylidene-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 5-ethylidene-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171037472 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 5-ethylidene-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC=C1C(=O)N(C)C(=O)C(C#N)=C1C |
| InChI | InChI=1S/C10H10N2O2/c1-4-7-6(2)8(5-11)10(14)12(3)9(7)13/h4H,1-3H3 |
| InChIKey | QUTJABOKCJRWLX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|